cas: 913835-28-6 — see every product listed under this CAS number, including other names
(3-(N-Cyclopropylsulfamoyl)phenyl)boronic acid 95% (CAS 913835-28-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A510244-100mg |
| cas | 913835-28-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 542.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A510244 |
[3-(cyclopropylsulfamoyl)phenyl]boronic acid (CAS 913835-28-6) is a chemical compound with the molecular formula C9H12BNO4S and a molecular weight of 241.08 g/mol. IUPAC name: [3-(cyclopropylsulfamoyl)phenyl]boronic acid. InChIKey: WIZSPBQIRRAOMO-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4S |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | [3-(cyclopropylsulfamoyl)phenyl]boronic acid |
| InChIKey | WIZSPBQIRRAOMO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)NC2CC2)(O)O |
Computed by PubChem (NCBI)