CAS 1072945-67-5 is the registry number for 3-(Cyclopropanesulfonamido)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-(cyclopropylsulfonylamino)phenyl]boronic acid (CAS 1072945-67-5) is a chemical compound with the molecular formula C9H12BNO4S and a molecular weight of 241.08 g/mol. IUPAC name: [3-(cyclopropylsulfonylamino)phenyl]boronic acid. InChIKey: KOKPMJFSMXUSJJ-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4S |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | [3-(cyclopropylsulfonylamino)phenyl]boronic acid |
| InChIKey | KOKPMJFSMXUSJJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NS(=O)(=O)C2CC2)(O)O |
Computed by PubChem (NCBI)