CAS 1072945-68-6 appears in our catalog under these names: 4-(Cyclopropanesulfonamido)phenylboronic acid, 98%, (4–(Cyclopropanesulfonamido)phenyl)boronic acid, (4-(Cyclopropanesulfonamido)phenyl)boronic acid 98%, B-[4-[(Cyclopropylsulfonyl)amino]phenyl]boronic acid, 98%, 98%, (4-(Cyclopropanesulfonamido)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg.
[4-(cyclopropylsulfonylamino)phenyl]boronic acid (CAS 1072945-68-6) is a chemical compound with the molecular formula C9H12BNO4S and a molecular weight of 241.08 g/mol. IUPAC name: [4-(cyclopropylsulfonylamino)phenyl]boronic acid. InChIKey: RYFOEMWOTGVANV-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4S |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | [4-(cyclopropylsulfonylamino)phenyl]boronic acid |
| InChIKey | RYFOEMWOTGVANV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NS(=O)(=O)C2CC2)(O)O |
Computed by PubChem (NCBI)