Products 1176093-78-9

CAS 1176093-78-9 is the registry number for 3-(1,1-Dioxido-2-isothiazolidinyl)phenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]boronic acid (CAS 1176093-78-9) is a chemical compound with the molecular formula C9H12BNO4S and a molecular weight of 241.08 g/mol. IUPAC name: [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]boronic acid. InChIKey: RWHVZNQSDFKSQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BNO4S
Molecular weight241.08 g/mol
IUPAC name[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]boronic acid
InChIKeyRWHVZNQSDFKSQQ-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)N2CCCS2(=O)=O)(O)O

Computed by PubChem (NCBI)