(3-(Naphthalen-2-yl)phenyl)boronic acid, 98%
cas: 870774-29-1 — see every product listed under this CAS number, including other names
(3-(Naphthalen-2-yl)phenyl)boronic acid, 98% (CAS 870774-29-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A247675-1g |
| cas | 870774-29-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 10g | 965.56 Pln | |
| Ambeed | 25g | 2133.69 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 352.40 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 553.16 Pln | |
| BLDpharm | 25g | 2296.99 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3-naphthalen-2-ylphenyl)boronic acid (CAS 870774-29-1) is a chemical compound with the molecular formula C16H13BO2 and a molecular weight of 248.1 g/mol. IUPAC name: (3-naphthalen-2-ylphenyl)boronic acid. InChIKey: WLKQDOGZCIYEOM-UHFFFAOYSA-N.
| Molecular formula | C16H13BO2 |
|---|---|
| Molecular weight | 248.1 g/mol |
| IUPAC name | (3-naphthalen-2-ylphenyl)boronic acid |
| InChIKey | WLKQDOGZCIYEOM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC3=CC=CC=C3C=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(2-Naphthyl)phenylboronic acid, (3-(Naphthalen-2-yl)phenyl)boronic acid, 3-(naphthalene-2-yl)phenylboronic acid, (3-naphthalen-2-ylphenyl)boronic acid, 3-(2-Naphthyl)benzeneboronic acid, 3-(naphthalen-2-yl)phenylboronic acid, (3-(Naphthalen-2-yl)phenyl)boronicacid, [3-(Naphthalen-2-yl)phenyl]boronic acid, 3-(2-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride), Boronic acid, [3-(2-naphthalenyl)phenyl]-