Products 2362573-88-2

CAS 2362573-88-2 is the registry number for (1-PHENYLNAPHTHALEN-2-YL)BORONIC ACID, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(1-phenylnaphthalen-2-yl)boronic acid (CAS 2362573-88-2) is a chemical compound with the molecular formula C16H13BO2 and a molecular weight of 248.1 g/mol. IUPAC name: (1-phenylnaphthalen-2-yl)boronic acid. InChIKey: DFGVPVXRDYZCIA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13BO2
Molecular weight248.1 g/mol
IUPAC name(1-phenylnaphthalen-2-yl)boronic acid
InChIKeyDFGVPVXRDYZCIA-UHFFFAOYSA-N
SMILESB(C1=C(C2=CC=CC=C2C=C1)C3=CC=CC=C3)(O)O

Computed by PubChem (NCBI)