CAS 500904-93-8 is the registry number for (2-(Naphthalen-1-yl)phenyl)boronic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
(2-naphthalen-1-ylphenyl)boronic acid (CAS 500904-93-8) is a chemical compound with the molecular formula C16H13BO2 and a molecular weight of 248.1 g/mol. IUPAC name: (2-naphthalen-1-ylphenyl)boronic acid. InChIKey: AOYYQPPLTDMTIY-UHFFFAOYSA-N.
| Molecular formula | C16H13BO2 |
|---|---|
| Molecular weight | 248.1 g/mol |
| IUPAC name | (2-naphthalen-1-ylphenyl)boronic acid |
| InChIKey | AOYYQPPLTDMTIY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC=CC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)