cas: 1100095-09-7 — see every product listed under this CAS number, including other names
(3-(Pyrrolidin-1-ylmethyl)phenyl)boronic acid, 98+% (CAS 1100095-09-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A787349-5g |
| cas | 1100095-09-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9633.19 Pln | |
| AmBeed | 10g | 16318.96 Pln | |
| AmBeed | 25g | 31975.51 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid (CAS 1100095-09-7) is a chemical compound with the molecular formula C11H16BNO2 and a molecular weight of 205.06 g/mol. IUPAC name: [3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid. InChIKey: JRGCMBMTOLSYTF-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO2 |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | [3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | JRGCMBMTOLSYTF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN2CCCC2)(O)O |
Computed by PubChem (NCBI)