Products 2578805-06-6
CAS 2578805-06-6 is the registry number for (2,8-Dimethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,8-dimethyl-3,4-dihydro-1H-isoquinolin-6-yl)boronic acid (CAS 2578805-06-6) is a chemical compound with the molecular formula C11H16BNO2 and a molecular weight of 205.06 g/mol. IUPAC name: (2,8-dimethyl-3,4-dihydro-1H-isoquinolin-6-yl)boronic acid. InChIKey: HGECQGMCXDIRQI-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO2 |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | (2,8-dimethyl-3,4-dihydro-1H-isoquinolin-6-yl)boronic acid |
| InChIKey | HGECQGMCXDIRQI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C2CN(CCC2=C1)C)C)(O)O |
Computed by PubChem (NCBI)