Products 2225173-84-0
CAS 2225173-84-0 appears in our catalog under these names: [2-Methyl-5-(pyrrolidin-1-yl)phenyl]boronic acid, 96%, 2–Methyl–5–(pyrrolidino)phenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 25mg, 5mg.
(2-methyl-5-pyrrolidin-1-ylphenyl)boronic acid (CAS 2225173-84-0) is a chemical compound with the molecular formula C11H16BNO2 and a molecular weight of 205.06 g/mol. IUPAC name: (2-methyl-5-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: WBNVGVCKVGFTRO-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO2 |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | (2-methyl-5-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | WBNVGVCKVGFTRO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)N2CCCC2)C)(O)O |
Computed by PubChem (NCBI)