cas: 723281-53-6 — see every product listed under this CAS number, including other names
(3-(Pyrrolidine-1-carbonyl)phenyl)boronic acid 98% (CAS 723281-53-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A804350-250mg |
| cas | 723281-53-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 526.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A804350 |
[3-(pyrrolidine-1-carbonyl)phenyl]boronic acid (CAS 723281-53-6) is a chemical compound with the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. IUPAC name: [3-(pyrrolidine-1-carbonyl)phenyl]boronic acid. InChIKey: SXTMJRKRWYTPLI-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO3 |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | [3-(pyrrolidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | SXTMJRKRWYTPLI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N2CCCC2)(O)O |
Computed by PubChem (NCBI)