CAS 1379476-58-0 appears in our catalog under these names: (4-(Cyclopropylcarbamoyl)-2-methylphenyl)boronic acid, 95%, (4–(Cyclopropylcarbamoyl)–2–methylphenyl)boronic acid, (4-(CyClopropylcarbamoyl)-2-methylphenyl)boronic acid, 97%, 97%, (4-(CYCLOPROPYLCARBAMOYL)-2-METHYLPHENYL)BORONIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[4-(cyclopropylcarbamoyl)-2-methylphenyl]boronic acid (CAS 1379476-58-0) is a chemical compound with the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. IUPAC name: [4-(cyclopropylcarbamoyl)-2-methylphenyl]boronic acid. InChIKey: IUZIQDNNJBRXRL-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO3 |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | [4-(cyclopropylcarbamoyl)-2-methylphenyl]boronic acid |
| InChIKey | IUZIQDNNJBRXRL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NC2CC2)C)(O)O |
Computed by PubChem (NCBI)