cas: 723281-53-6 — see every product listed under this CAS number, including other names
(3-(Pyrrolidine-1-carbonyl)phenyl)boronic acid, 98% (CAS 723281-53-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694147-5G |
| cas | 723281-53-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 450.90 Pln | |
| Fluorochem | 10g | 846.59 Pln | |
| Fluorochem | 25g | 1955.58 Pln | |
| Fluorochem | 100g | 5745.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[3-(pyrrolidine-1-carbonyl)phenyl]boronic acid (CAS 723281-53-6) is a chemical compound with the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. IUPAC name: [3-(pyrrolidine-1-carbonyl)phenyl]boronic acid. InChIKey: SXTMJRKRWYTPLI-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO3 |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | [3-(pyrrolidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | SXTMJRKRWYTPLI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N2CCCC2)(O)O |
Computed by PubChem (NCBI)