CAS 2377609-10-2 is the registry number for [2-Cyano-3-(2-methylpropoxy)phenyl]boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
[2-cyano-3-(2-methylpropoxy)phenyl]boronic acid (CAS 2377609-10-2) is a chemical compound with the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. IUPAC name: [2-cyano-3-(2-methylpropoxy)phenyl]boronic acid. InChIKey: MMHWYTQWFCETAB-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO3 |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | [2-cyano-3-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | MMHWYTQWFCETAB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OCC(C)C)C#N)(O)O |
Computed by PubChem (NCBI)