cas: 193905-93-0 — see every product listed under this CAS number, including other names
(3-(tert-Butyl)-5-methylphenyl)boronic acid 98% (CAS 193905-93-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193205-250mg |
| cas | 193905-93-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2645.44 Pln | |
| Ambeed | 10g | 4442.12 Pln | |
| Ambeed | 25g | 8814.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A193205 |
(3-tert-butyl-5-methylphenyl)boronic acid (CAS 193905-93-0) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: (3-tert-butyl-5-methylphenyl)boronic acid. InChIKey: XWWPIVKWAIMBMU-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | (3-tert-butyl-5-methylphenyl)boronic acid |
| InChIKey | XWWPIVKWAIMBMU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)