CAS 2377606-81-8 appears in our catalog under these names: (5-tert-butyl-2-methylphenyl)boronic acid, 95%, (5-(tert-Butyl)-2-methylphenyl)boronic acid, 98%, (5-(tert-butyl)-2-methylphenyl)boronic acid, ≥95%, ≥95%, (5-tert-Butyl-2-methylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
(5-tert-butyl-2-methylphenyl)boronic acid (CAS 2377606-81-8) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: (5-tert-butyl-2-methylphenyl)boronic acid. InChIKey: WXDBCQYFANMNDC-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | (5-tert-butyl-2-methylphenyl)boronic acid |
| InChIKey | WXDBCQYFANMNDC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)