Products 121219-12-3
CAS 121219-12-3 appears in our catalog under these names: 4-Pentylphenylboronic acid, 98%, 4–n–Pentylbenzeneboronic acid (contains varying amounts of Anhydride), 4-Amylphenylboronic Acid (contains varying amounts of Anhydride), (4-Pentylphenyl)boronic acid 97%, (4-Pentylphenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 10g, 50g.
(4-pentylphenyl)boronic acid (CAS 121219-12-3) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: (4-pentylphenyl)boronic acid. InChIKey: UZRMPSOGFATLJE-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | (4-pentylphenyl)boronic acid |
| InChIKey | UZRMPSOGFATLJE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-pentylphenyl)boronic Acid, 4-n-Pentylphenylboronic acid, 4-Pentylphenylboronic Acid, 4-Pentylbenzeneboronic acid, 4-Amylphenylboronic Acid, Boronic acid, (4-pentylphenyl)-, 4-n-pentylphenyl boronic acid, 4-n-pentylbenzene boronic acid, 4-Amylbenzeneboronic Acid, 4-n-Pentylbenzeneboronic acid (contains varying amounts of Anhydride)