CAS 1028205-76-6 appears in our catalog under these names: 2,3,4,5,6-Pentamethylphenylboronic acid, 95%, 2,3,4,5,6-Pentamethylphenylboronic Acid, 98%, 98%, 2,3,4,5,6-Pentamethylphenylboronic Acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 25g.
(2,3,4,5,6-pentamethylphenyl)boronic acid (CAS 1028205-76-6) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: (2,3,4,5,6-pentamethylphenyl)boronic acid. InChIKey: UJTUQGRGYLGFBX-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | (2,3,4,5,6-pentamethylphenyl)boronic acid |
| InChIKey | UJTUQGRGYLGFBX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1C)C)C)C)C)(O)O |
Computed by PubChem (NCBI)