cas: 1451392-94-1 — see every product listed under this CAS number, including other names
(3-Bromo-2,6-dichlorophenyl)boronic acid, 98+% (CAS 1451392-94-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A504462-25g |
| cas | 1451392-94-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 25374.37 Pln | |
| AmBeed | 10g | 12933.76 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-bromo-2,6-dichlorophenyl)boronic acid (CAS 1451392-94-1) is a chemical compound with the molecular formula C6H4BBrCl2O2 and a molecular weight of 269.71 g/mol. IUPAC name: (3-bromo-2,6-dichlorophenyl)boronic acid. InChIKey: ZRMOEVKPJFFEND-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrCl2O2 |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | (3-bromo-2,6-dichlorophenyl)boronic acid |
| InChIKey | ZRMOEVKPJFFEND-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)Br)Cl)(O)O |
Computed by PubChem (NCBI)