CAS 1451392-94-1 appears in our catalog under these names: 3-Bromo-2,6-dichlorophenylboronic acid, 95%, (3-Bromo-2,6-dichlorophenyl)boronic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(3-bromo-2,6-dichlorophenyl)boronic acid (CAS 1451392-94-1) is a chemical compound with the molecular formula C6H4BBrCl2O2 and a molecular weight of 269.71 g/mol. IUPAC name: (3-bromo-2,6-dichlorophenyl)boronic acid. InChIKey: ZRMOEVKPJFFEND-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrCl2O2 |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | (3-bromo-2,6-dichlorophenyl)boronic acid |
| InChIKey | ZRMOEVKPJFFEND-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)Br)Cl)(O)O |
Computed by PubChem (NCBI)