CAS 2121513-17-3 appears in our catalog under these names: 3-Bromo-2,5-dichlorophenylboronic acid, 95%, (3-Bromo-2,5-dichlorophenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(3-bromo-2,5-dichlorophenyl)boronic acid (CAS 2121513-17-3) is a chemical compound with the molecular formula C6H4BBrCl2O2 and a molecular weight of 269.71 g/mol. IUPAC name: (3-bromo-2,5-dichlorophenyl)boronic acid. InChIKey: UBPASQAXQSYNRH-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrCl2O2 |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | (3-bromo-2,5-dichlorophenyl)boronic acid |
| InChIKey | UBPASQAXQSYNRH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Cl)Br)Cl)(O)O |
Computed by PubChem (NCBI)