CAS 2121511-62-2 appears in our catalog under these names: 4-Bromo-3,5-dichlorophenylboronic acid, 97%, (4-Bromo-3,5-dichlorophenyl)boronic acid, 98%, (4-Bromo-3,5-dichlorophenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
(4-bromo-3,5-dichlorophenyl)boronic acid (CAS 2121511-62-2) is a chemical compound with the molecular formula C6H4BBrCl2O2 and a molecular weight of 269.71 g/mol. IUPAC name: (4-bromo-3,5-dichlorophenyl)boronic acid. InChIKey: FIIAWVYUPICPON-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrCl2O2 |
|---|---|
| Molecular weight | 269.71 g/mol |
| IUPAC name | (4-bromo-3,5-dichlorophenyl)boronic acid |
| InChIKey | FIIAWVYUPICPON-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)Br)Cl)(O)O |
Computed by PubChem (NCBI)