(3-Bromo-4-chloro-2-fluorophenyl)boronic acid, 98%
cas: 1987879-74-2 — see every product listed under this CAS number, including other names
(3-Bromo-4-chloro-2-fluorophenyl)boronic acid, 98% (CAS 1987879-74-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A694554-100mg |
| cas | 1987879-74-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 686.45 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(3-bromo-4-chloro-2-fluorophenyl)boronic acid (CAS 1987879-74-2) is a chemical compound with the molecular formula C6H4BBrClFO2 and a molecular weight of 253.26 g/mol. IUPAC name: (3-bromo-4-chloro-2-fluorophenyl)boronic acid. InChIKey: NCASPTLBORLQPV-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrClFO2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | (3-bromo-4-chloro-2-fluorophenyl)boronic acid |
| InChIKey | NCASPTLBORLQPV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)Br)F)(O)O |
Computed by PubChem (NCBI)