CAS 1987879-74-2 appears in our catalog under these names: 3-Bromo-4-chloro-2-fluorophenylboronic acid, 98%, (3-Bromo-4-chloro-2-fluorophenyl)boronic acid 98%, 3-Bromo-4-chloro-2-fluorophenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(3-bromo-4-chloro-2-fluorophenyl)boronic acid (CAS 1987879-74-2) is a chemical compound with the molecular formula C6H4BBrClFO2 and a molecular weight of 253.26 g/mol. IUPAC name: (3-bromo-4-chloro-2-fluorophenyl)boronic acid. InChIKey: NCASPTLBORLQPV-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrClFO2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | (3-bromo-4-chloro-2-fluorophenyl)boronic acid |
| InChIKey | NCASPTLBORLQPV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)Br)F)(O)O |
Computed by PubChem (NCBI)