CAS 2795134-19-7 is the registry number for (2-Bromo-4-chloro-6-fluorophenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2-bromo-4-chloro-6-fluorophenyl)boronic acid (CAS 2795134-19-7) is a chemical compound with the molecular formula C6H4BBrClFO2 and a molecular weight of 253.26 g/mol. IUPAC name: (2-bromo-4-chloro-6-fluorophenyl)boronic acid. InChIKey: FLBOJJPUUNTDGU-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrClFO2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | (2-bromo-4-chloro-6-fluorophenyl)boronic acid |
| InChIKey | FLBOJJPUUNTDGU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Br)Cl)F)(O)O |
Computed by PubChem (NCBI)