Products 1451393-27-3
CAS 1451393-27-3 appears in our catalog under these names: 5–Bromo–3–chloro–2–fluorophenylboronic acid, 5-Bromo-3-chloro-2-fluorophenylboronic acid, 97%, 5-Bromo-3-chloro-2-fluorophenylboronic acid, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
(5-bromo-3-chloro-2-fluorophenyl)boronic acid (CAS 1451393-27-3) is a chemical compound with the molecular formula C6H4BBrClFO2 and a molecular weight of 253.26 g/mol. IUPAC name: (5-bromo-3-chloro-2-fluorophenyl)boronic acid. InChIKey: JDUOEAUGCPUWHW-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrClFO2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | (5-bromo-3-chloro-2-fluorophenyl)boronic acid |
| InChIKey | JDUOEAUGCPUWHW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)Cl)Br)(O)O |
Computed by PubChem (NCBI)