cas: 1072951-48-4 — see every product listed under this CAS number, including other names
(3-Bromo-5-(trifluoromethoxy)phenyl)boronic acid, 97%, 97% (CAS 1072951-48-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ES1-1g |
| cas | 1072951-48-4 |
| size | 1g |
| availability | 1.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 611.60 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 342.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-bromo-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1072951-48-4) is a chemical compound with the molecular formula C7H5BBrF3O3 and a molecular weight of 284.82 g/mol. IUPAC name: [3-bromo-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: MRIQPQPZRLURMR-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrF3O3 |
|---|---|
| Molecular weight | 284.82 g/mol |
| IUPAC name | [3-bromo-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | MRIQPQPZRLURMR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)