CAS 959997-86-5 appears in our catalog under these names: 2-Bromo-4-(trifluoromethoxy)phenylboronic acid, 98%, 2-BROMO-4-(TRIFLUOROMETHOXY)PHENYLBORONIC ACID, ≥95%, (2-Bromo-4-(trifluoromethoxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
[2-bromo-4-(trifluoromethoxy)phenyl]boronic acid (CAS 959997-86-5) is a chemical compound with the molecular formula C7H5BBrF3O3 and a molecular weight of 284.82 g/mol. IUPAC name: [2-bromo-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: WRAOUQSLNOJJFK-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrF3O3 |
|---|---|
| Molecular weight | 284.82 g/mol |
| IUPAC name | [2-bromo-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | WRAOUQSLNOJJFK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(F)(F)F)Br)(O)O |
Computed by PubChem (NCBI)