Products 957034-55-8

CAS 957034-55-8 appears in our catalog under these names: 2-Bromo-5-trifluoromethoxyphenylboronic acid, 96%, (2-Bromo-5-(trifluoromethoxy)phenyl)boronic acid 98%, (2-Bromo-5-(trifluoromethoxy)phenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[2-bromo-5-(trifluoromethoxy)phenyl]boronic acid (CAS 957034-55-8) is a chemical compound with the molecular formula C7H5BBrF3O3 and a molecular weight of 284.82 g/mol. IUPAC name: [2-bromo-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: QSBIMKBCXNIDTI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BBrF3O3
Molecular weight284.82 g/mol
IUPAC name[2-bromo-5-(trifluoromethoxy)phenyl]boronic acid
InChIKeyQSBIMKBCXNIDTI-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)OC(F)(F)F)Br)(O)O

Computed by PubChem (NCBI)