CAS 1048990-22-2 is the registry number for 4-Bromo-2-(trifluoromethoxy)phenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
[4-bromo-2-(trifluoromethoxy)phenyl]boronic acid (CAS 1048990-22-2) is a chemical compound with the molecular formula C7H5BBrF3O3 and a molecular weight of 284.82 g/mol. IUPAC name: [4-bromo-2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: NXVYGJHJHNUQDB-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrF3O3 |
|---|---|
| Molecular weight | 284.82 g/mol |
| IUPAC name | [4-bromo-2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | NXVYGJHJHNUQDB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Br)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)