cas: 1217500-55-4 — see every product listed under this CAS number, including other names
(3-Chloro-2-fluoropyridin-4-yl)boronic acid, 97% (CAS 1217500-55-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228502-1G |
| cas | 1217500-55-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 987.17 Pln | |
| Fluorochem | 25g | 1794.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3-chloro-2-fluoro-4-pyridinyl)boronic acid (CAS 1217500-55-4) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (3-chloro-2-fluoro-4-pyridinyl)boronic acid. InChIKey: VYHSSQRGIWMXJE-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (3-chloro-2-fluoro-4-pyridinyl)boronic acid |
| InChIKey | VYHSSQRGIWMXJE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)F)Cl)(O)O |
Computed by PubChem (NCBI)