(3-Chloro-5-methylphenyl)boronic acid, 96%
cas: 913836-14-3 — see every product listed under this CAS number, including other names
(3-Chloro-5-methylphenyl)boronic acid, 96% (CAS 913836-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 100g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch117BHK-100mg |
| cas | 913836-14-3 |
| size | 100mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 100g | 4317.20 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 404.04 Pln | |
| Fluorochem | 10g | 747.67 Pln | |
| Fluorochem | 25g | 1257.91 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(3-chloro-5-methylphenyl)boronic acid (CAS 913836-14-3) is a chemical compound with the molecular formula C7H8BClO2 and a molecular weight of 170.40 g/mol. IUPAC name: (3-chloro-5-methylphenyl)boronic acid. InChIKey: QXHLBINWDJITMJ-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO2 |
|---|---|
| Molecular weight | 170.40 g/mol |
| IUPAC name | (3-chloro-5-methylphenyl)boronic acid |
| InChIKey | QXHLBINWDJITMJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)C)(O)O |
Computed by PubChem (NCBI)