cas: 157764-10-8 — see every product listed under this CAS number, including other names
(3-Chloro-5-trifluoromethyl-pyridin-2-yl)-acetonitrile, 98% (CAS 157764-10-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317478-1G |
| cas | 157764-10-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 638.33 Pln | |
| Fluorochem | 10g | 1226.67 Pln | |
| Fluorochem | 25g | 2970.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetonitrile (CAS 157764-10-8) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetonitrile. InChIKey: QSFVBRUYPUNIPH-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetonitrile |
| InChIKey | QSFVBRUYPUNIPH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)CC#N)C(F)(F)F |
Computed by PubChem (NCBI)