CAS 1196507-58-0 appears in our catalog under these names: 4-Chloro-5-(trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 4–Chloro–5–(trifluoromethyl)–1H–pyrrolo(2,3–b)pyridine, 4-CHLORO-5-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE, 98%, 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
4-chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1196507-58-0) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 4-chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: ATLADCFKPSZUNL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 4-chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | ATLADCFKPSZUNL-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)Cl)C(F)(F)F |
Computed by PubChem (NCBI)