CAS 932406-36-5 appears in our catalog under these names: 6-Chloro-3-(trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 6–Chloro–3–(trifluoromethyl)–1H–pyrrolo(2,3–b)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-chloro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 932406-36-5) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 6-chloro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: BZGSFGFNHIPAIZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 6-chloro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | BZGSFGFNHIPAIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CN2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)