CAS 112601-16-8 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine, 95%, 2–Chloro–6–(Trifluoromethyl)Imidazo(1,2–A)Pyridine, 2-chloro-6-(trifluoromethyl)imidazo(1,2-a)pyridine, Imidazo[1,2-a]pyridine, 2-chloro-6-(trifluoromethyl)-, 97%, 97%, 2-CHLORO-6-(TRIFLUOROMETHYL)IMIDAZO[1,2-A]PYRIDINE, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 500mg.
2-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 112601-16-8) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: RDWNBEBIDGNGFK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | RDWNBEBIDGNGFK-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)