cas: 63012-03-3 — see every product listed under this CAS number, including other names
(3-Chlorophenyl)(phenyl)methanol, 95% (CAS 63012-03-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0CJ-250mg |
| cas | 63012-03-3 |
| size | 250mg |
| availability | 175g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 357.20 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 236.61 Pln | |
| BLDpharm | 25g | 469.86 Pln | |
| BLDpharm | 100g | 1525.04 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3-chlorophenyl)-phenylmethanol (CAS 63012-03-3) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: (3-chlorophenyl)-phenylmethanol. InChIKey: DDCJHFYXAPQYLA-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | (3-chlorophenyl)-phenylmethanol |
| InChIKey | DDCJHFYXAPQYLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)