CAS 7700-27-8 appears in our catalog under these names: 4-Benzyloxychlorobenzene, 98%, 1-(Benzyloxy)-4-chlorobenzene 98%, 1-(Benzyloxy)-4-chlorobenzene, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 10g, 500g.
1-chloro-4-phenylmethoxybenzene (CAS 7700-27-8) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: 1-chloro-4-phenylmethoxybenzene. InChIKey: OBCBJNFGAMHBTC-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 1-chloro-4-phenylmethoxybenzene |
| InChIKey | OBCBJNFGAMHBTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)