CAS 4039-92-3 appears in our catalog under these names: 1-(Chloromethyl)-4-phenoxybenzene, 95%, 1–(Chloromethyl)–4–phenoxybenzene, 1-(Chloromethyl)-4-phenoxybenzene 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
1-(chloromethyl)-4-phenoxybenzene (CAS 4039-92-3) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: 1-(chloromethyl)-4-phenoxybenzene. InChIKey: IATNZRYVIRYKDJ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 1-(chloromethyl)-4-phenoxybenzene |
| InChIKey | IATNZRYVIRYKDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)