CAS 22494-48-0 appears in our catalog under these names: (4'-Chlorobiphenyl-4-yl)-methanol, 95%, (4'-Chloro-(1,1'-biphenyl)-4-yl)methanol, 97%, 4-(4-Chlorophenyl)benzylalcohol, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[4-(4-chlorophenyl)phenyl]methanol (CAS 22494-48-0) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: [4-(4-chlorophenyl)phenyl]methanol. InChIKey: SKCQMBTWYIRYCY-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | [4-(4-chlorophenyl)phenyl]methanol |
| InChIKey | SKCQMBTWYIRYCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)