(3-Formyl-4-methylphenyl)boronic acid, 97%, 97%
cas: 1106869-99-1 — see every product listed under this CAS number, including other names
(3-Formyl-4-methylphenyl)boronic acid, 97%, 97% (CAS 1106869-99-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBR0-100mg |
| cas | 1106869-99-1 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 520.40 Pln | |
| Chemat | 25g | 1778.00 Pln | |
| Chemat | 10g | 861.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-formyl-4-methylphenyl)boronic acid (CAS 1106869-99-1) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (3-formyl-4-methylphenyl)boronic acid. InChIKey: UHPDMPNTUUASKT-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (3-formyl-4-methylphenyl)boronic acid |
| InChIKey | UHPDMPNTUUASKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C=O)(O)O |
Computed by PubChem (NCBI)