cas: 84938-44-3 — see every product listed under this CAS number, including other names
(3-Hydroxyadamantan-1-yl)methyl acetate, 97% (CAS 84938-44-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A771502-5g |
| cas | 84938-44-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 25120.48 Pln | |
| AmBeed | 1g | 8363.74 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-hydroxy-1-adamantyl)methyl acetate (CAS 84938-44-3) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: (3-hydroxy-1-adamantyl)methyl acetate. InChIKey: TVHARAGBLXWMGF-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | (3-hydroxy-1-adamantyl)methyl acetate |
| InChIKey | TVHARAGBLXWMGF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12CC3CC(C1)CC(C3)(C2)O |
Computed by PubChem (NCBI)