Products 466683-24-9
CAS 466683-24-9 is the registry number for 3-Ethyl-5-hydroxyadamantane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-ethyl-5-hydroxyadamantane-1-carboxylic acid (CAS 466683-24-9) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: 3-ethyl-5-hydroxyadamantane-1-carboxylic acid. InChIKey: OWTGEISDJULWJQ-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 3-ethyl-5-hydroxyadamantane-1-carboxylic acid |
| InChIKey | OWTGEISDJULWJQ-UHFFFAOYSA-N |
| SMILES | CCC12CC3CC(C1)(CC(C3)(C2)O)C(=O)O |
Computed by PubChem (NCBI)