CAS 84938-44-3 appears in our catalog under these names: (3-Hydroxyadamantan-1-yl)methyl acetate, 95%, (3-Hydroxyadamantan-1-yl)methyl acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(3-hydroxy-1-adamantyl)methyl acetate (CAS 84938-44-3) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: (3-hydroxy-1-adamantyl)methyl acetate. InChIKey: TVHARAGBLXWMGF-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | (3-hydroxy-1-adamantyl)methyl acetate |
| InChIKey | TVHARAGBLXWMGF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12CC3CC(C1)CC(C3)(C2)O |
Computed by PubChem (NCBI)