CAS 1313617-76-3 appears in our catalog under these names: 3-Methoxy-2-methylbenzeneboronic acid, (3–Methoxy–2–methylphenyl)boronic acid, 3-Methoxy-2-methylphenylboronic acid, 95-<97%, 3-Methoxy-2-methylphenylboronic acid, ≥97-<99%, (3-Methoxy-2-methylphenyl)boronic acid, 96%. Offered by: Biosynth, GLPBio, Hoffman Fine Chemicals, Fluorochem, Ambeed. Available pack sizes: 2,5g, 1g, 250mg, 10g, 25g, 50g, 100g, 200g.
(3-methoxy-2-methylphenyl)boronic acid (CAS 1313617-76-3) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (3-methoxy-2-methylphenyl)boronic acid. InChIKey: FISOIOAMTHXGEL-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (3-methoxy-2-methylphenyl)boronic acid |
| InChIKey | FISOIOAMTHXGEL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OC)C)(O)O |
Computed by PubChem (NCBI)