CAS 1218790-88-5 appears in our catalog under these names: 4-Hydroxymethyl-3-methylphenylboronic acid, 98%, (4-(Hydroxymethyl)-3-methylphenyl)boronic acid 96%, (4-(Hydroxymethyl)-3-Methylphenyl)Boronic Acid, 96%, 96%, (4-(Hydroxymethyl)-3-methylphenyl)boronic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
[4-(hydroxymethyl)-3-methylphenyl]boronic acid (CAS 1218790-88-5) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: [4-(hydroxymethyl)-3-methylphenyl]boronic acid. InChIKey: SLIUMAXFJNQYHZ-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | [4-(hydroxymethyl)-3-methylphenyl]boronic acid |
| InChIKey | SLIUMAXFJNQYHZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CO)C)(O)O |
Computed by PubChem (NCBI)