Products 934826-20-7
CAS 934826-20-7 appears in our catalog under these names: 4-Hydroxy-3,5-dimethylphenylboronic acid, 96%, (4-Hydroxy-3,5-dimethylphenyl)boronic acid, 96%, (4-Hydroxy-3,5-dimethylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
(4-hydroxy-3,5-dimethylphenyl)boronic acid (CAS 934826-20-7) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (4-hydroxy-3,5-dimethylphenyl)boronic acid. InChIKey: SJSCEQJHOXBRSS-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (4-hydroxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | SJSCEQJHOXBRSS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)O)C)(O)O |
Computed by PubChem (NCBI)