Products 909187-39-9
CAS 909187-39-9 appears in our catalog under these names: 2-Methoxy-3-methylphenyl boronic acid, 98%, (2-Methoxy-3-methylphenyl)boronic acid 98%, (2-Methoxy-3-methylphenyl)boronic acid, 98%, 98%, (2-Methoxy-3-methylphenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
(2-methoxy-3-methylphenyl)boronic acid (CAS 909187-39-9) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (2-methoxy-3-methylphenyl)boronic acid. InChIKey: RGEFKQADFIJDCW-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (2-methoxy-3-methylphenyl)boronic acid |
| InChIKey | RGEFKQADFIJDCW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C)OC)(O)O |
Computed by PubChem (NCBI)