cas: 864759-67-1 — see every product listed under this CAS number, including other names
(3-Methyl-4-(trifluoromethyl)phenyl)boronic acid 95% (CAS 864759-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A319925-100mg |
| cas | 864759-67-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 392.62 Pln | |
| Ambeed | 5g | 1499.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A319925 |
[3-methyl-4-(trifluoromethyl)phenyl]boronic acid (CAS 864759-67-1) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [3-methyl-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: WYIPXMTWQBAPEE-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [3-methyl-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WYIPXMTWQBAPEE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)