Products 947533-94-0
CAS 947533-94-0 appears in our catalog under these names: 4-Methyl-3-trifluoromethyl-phenylboronic acid, 98%, (4-Methyl-3-(trifluoromethyl)phenyl)boronic acid, 97%, 97%, (4-Methyl-3-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 25g, 1g, 250mg, 50mg.
[4-methyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 947533-94-0) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [4-methyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: LXQGVSGCAAPNEL-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [4-methyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | LXQGVSGCAAPNEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)